C30H21N3O — CID 136592861
2-(4,6-dinaphthalen-1-yl-1,3,5-triazin-2-yl)-5-methylphenol (PubChem CID 136592861) has the molecular formula C30H21N3O and a molecular weight of 439.52 g/mol. Its IUPAC name is 2-(4,6-dinaphthalen-1-yl-1,3,5-triazin-2-yl)-5-methylphenol.
| Compound Name | 2-(4,6-dinaphthalen-1-yl-1,3,5-triazin-2-yl)-5-methylphenol |
|---|---|
| PubChem CID | 136592861 |
| Molecular Formula | C30H21N3O |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | 2-(4,6-dinaphthalen-1-yl-1,3,5-triazin-2-yl)-5-methylphenol |
| SMILES | Cc1ccc(-c2nc(-c3cccc4ccccc34)nc(-c3cccc4ccccc34)n2)c(O)c1 |
| InChI | InChI=1S/C30H21N3O/c1-19-16-17-26(27(34)18-19)30-32-28(24-14-6-10-20-8-2-4-12-22(20)24)31-29(33-30)25-15-7-11-21-9-3-5-13-23(21)25/h2-18,34H,1H3 |
| InChIKey | VPQBWTARNGRASW-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |