C48H32N6O — CID 155050379
2-[4-[4-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenoxy]phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 155050379) has the molecular formula C48H32N6O and a molecular weight of 708.83 g/mol. Its IUPAC name is 2-[4-[4-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenoxy]phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[4-[4-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenoxy]phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 155050379 |
| Molecular Formula | C48H32N6O |
| Molecular Weight | 708.83 g/mol |
| Exact Mass | 708.26 |
| IUPAC Name | 2-[4-[4-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenoxy]phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(-c4ccc(Oc5cccc(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)c5)cc4)cc3)n2)cc1 |
| InChI | InChI=1S/C48H32N6O/c1-5-14-35(15-6-1)43-49-44(36-16-7-2-8-17-36)52-47(51-43)39-26-24-33(25-27-39)34-28-30-41(31-29-34)55-42-23-13-22-40(32-42)48-53-45(37-18-9-3-10-19-37)50-46(54-48)38-20-11-4-12-21-38/h1-32H |
| InChIKey | UOAMMWUOCMHXQW-UHFFFAOYSA-N |
| XLogP | 11.52 |
| TPSA | 86.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.83 |
| LogP ≤ 5 | 11.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |