C49H31N7O — CID 161050070
2-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenoxy]phenyl]-4-[4-(2-isocyanophenyl)phenyl]-6-phenyl-1,3,5-triazine (PubChem CID 161050070) has the molecular formula C49H31N7O and a molecular weight of 733.84 g/mol. Its IUPAC name is 2-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenoxy]phenyl]-4-[4-(2-isocyanophenyl)phenyl]-6-phenyl-1,3,5-triazine.
| Compound Name | 2-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenoxy]phenyl]-4-[4-(2-isocyanophenyl)phenyl]-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 161050070 |
| Molecular Formula | C49H31N7O |
| Molecular Weight | 733.84 g/mol |
| Exact Mass | 733.26 |
| IUPAC Name | 2-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenoxy]phenyl]-4-[4-(2-isocyanophenyl)phenyl]-6-phenyl-1,3,5-triazine |
| SMILES | [C-]#[N+]c1ccccc1-c1ccc(-c2nc(-c3ccccc3)nc(-c3cccc(Oc4cccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)c4)c3)n2)cc1 |
| InChI | InChI=1S/C49H31N7O/c1-50-43-26-12-11-25-42(43)33-27-29-37(30-28-33)47-52-46(36-19-9-4-10-20-36)55-49(56-47)39-22-14-24-41(32-39)57-40-23-13-21-38(31-40)48-53-44(34-15-5-2-6-16-34)51-45(54-48)35-17-7-3-8-18-35/h2-32H |
| InChIKey | KOYYGPUWVZKSOM-UHFFFAOYSA-N |
| XLogP | 12.07 |
| TPSA | 90.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.84 |
| LogP ≤ 5 | 12.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|