C50H30N6O — CID 157223333
2-[6-[6-[4-(2-isocyanophenyl)phenyl]-2-phenylpyrimidin-4-yl]dibenzofuran-3-yl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 157223333) has the molecular formula C50H30N6O and a molecular weight of 730.83 g/mol. Its IUPAC name is 2-[6-[6-[4-(2-isocyanophenyl)phenyl]-2-phenylpyrimidin-4-yl]dibenzofuran-3-yl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[6-[6-[4-(2-isocyanophenyl)phenyl]-2-phenylpyrimidin-4-yl]dibenzofuran-3-yl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 157223333 |
| Molecular Formula | C50H30N6O |
| Molecular Weight | 730.83 g/mol |
| Exact Mass | 730.25 |
| IUPAC Name | 2-[6-[6-[4-(2-isocyanophenyl)phenyl]-2-phenylpyrimidin-4-yl]dibenzofuran-3-yl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | [C-]#[N+]c1ccccc1-c1ccc(-c2cc(-c3cccc4c3oc3cc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)ccc34)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C50H30N6O/c1-51-42-23-12-11-20-38(42)32-24-26-33(27-25-32)43-31-44(53-47(52-43)34-14-5-2-6-15-34)41-22-13-21-40-39-29-28-37(30-45(39)57-46(40)41)50-55-48(35-16-7-3-8-17-35)54-49(56-50)36-18-9-4-10-19-36/h2-31H |
| InChIKey | ANXBMRRSOIYREA-UHFFFAOYSA-N |
| XLogP | 12.78 |
| TPSA | 81.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.83 |
| LogP ≤ 5 | 12.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|