C40H24N4O — CID 168774617
2-[4-(2-isocyanophenyl)phenyl]-4-phenyl-6-(9-phenyldibenzofuran-3-yl)-1,3,5-triazine (PubChem CID 168774617) has the molecular formula C40H24N4O and a molecular weight of 576.66 g/mol. Its IUPAC name is 2-[4-(2-isocyanophenyl)phenyl]-4-phenyl-6-(9-phenyldibenzofuran-3-yl)-1,3,5-triazine.
| Compound Name | 2-[4-(2-isocyanophenyl)phenyl]-4-phenyl-6-(9-phenyldibenzofuran-3-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 168774617 |
| Molecular Formula | C40H24N4O |
| Molecular Weight | 576.66 g/mol |
| Exact Mass | 576.20 |
| IUPAC Name | 2-[4-(2-isocyanophenyl)phenyl]-4-phenyl-6-(9-phenyldibenzofuran-3-yl)-1,3,5-triazine |
| SMILES | [C-]#[N+]c1ccccc1-c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc4c(c3)oc3cccc(-c5ccccc5)c34)n2)cc1 |
| InChI | InChI=1S/C40H24N4O/c1-41-34-17-9-8-15-31(34)27-19-21-29(22-20-27)39-42-38(28-13-6-3-7-14-28)43-40(44-39)30-23-24-33-36(25-30)45-35-18-10-16-32(37(33)35)26-11-4-2-5-12-26/h2-25H |
| InChIKey | HGLPUCYDENMTTK-UHFFFAOYSA-N |
| XLogP | 10.66 |
| TPSA | 56.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.66 |
| LogP ≤ 5 | 10.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|