C58H36N4O — CID 168774751
2-(3,5-diphenylphenyl)-4-[3-(2-isocyanophenyl)phenyl]-6-[9-(4-phenylphenyl)dibenzofuran-3-yl]-1,3,5-triazine (PubChem CID 168774751) has the molecular formula C58H36N4O and a molecular weight of 804.95 g/mol. Its IUPAC name is 2-(3,5-diphenylphenyl)-4-[3-(2-isocyanophenyl)phenyl]-6-[9-(4-phenylphenyl)dibenzofuran-3-yl]-1,3,5-triazine.
| Compound Name | 2-(3,5-diphenylphenyl)-4-[3-(2-isocyanophenyl)phenyl]-6-[9-(4-phenylphenyl)dibenzofuran-3-yl]-1,3,5-triazine |
|---|---|
| PubChem CID | 168774751 |
| Molecular Formula | C58H36N4O |
| Molecular Weight | 804.95 g/mol |
| Exact Mass | 804.29 |
| IUPAC Name | 2-(3,5-diphenylphenyl)-4-[3-(2-isocyanophenyl)phenyl]-6-[9-(4-phenylphenyl)dibenzofuran-3-yl]-1,3,5-triazine |
| SMILES | [C-]#[N+]c1ccccc1-c1cccc(-c2nc(-c3cc(-c4ccccc4)cc(-c4ccccc4)c3)nc(-c3ccc4c(c3)oc3cccc(-c5ccc(-c6ccccc6)cc5)c34)n2)c1 |
| InChI | InChI=1S/C58H36N4O/c1-59-52-25-12-11-23-49(52)43-21-13-22-44(33-43)56-60-57(62-58(61-56)48-35-46(39-17-7-3-8-18-39)34-47(36-48)40-19-9-4-10-20-40)45-31-32-51-54(37-45)63-53-26-14-24-50(55(51)53)42-29-27-41(28-30-42)38-15-5-2-6-16-38/h2-37H |
| InChIKey | ZWHVAMMWQVFDAT-UHFFFAOYSA-N |
| XLogP | 15.66 |
| TPSA | 56.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.95 |
| LogP ≤ 5 | 15.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|