C46H28N4O — CID 168774741
2-[3-(2-isocyanophenyl)-5-phenylphenyl]-4-phenyl-6-(9-phenyldibenzofuran-3-yl)-1,3,5-triazine (PubChem CID 168774741) has the molecular formula C46H28N4O and a molecular weight of 652.76 g/mol. Its IUPAC name is 2-[3-(2-isocyanophenyl)-5-phenylphenyl]-4-phenyl-6-(9-phenyldibenzofuran-3-yl)-1,3,5-triazine.
| Compound Name | 2-[3-(2-isocyanophenyl)-5-phenylphenyl]-4-phenyl-6-(9-phenyldibenzofuran-3-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 168774741 |
| Molecular Formula | C46H28N4O |
| Molecular Weight | 652.76 g/mol |
| Exact Mass | 652.23 |
| IUPAC Name | 2-[3-(2-isocyanophenyl)-5-phenylphenyl]-4-phenyl-6-(9-phenyldibenzofuran-3-yl)-1,3,5-triazine |
| SMILES | [C-]#[N+]c1ccccc1-c1cc(-c2ccccc2)cc(-c2nc(-c3ccccc3)nc(-c3ccc4c(c3)oc3cccc(-c5ccccc5)c34)n2)c1 |
| InChI | InChI=1S/C46H28N4O/c1-47-40-22-12-11-20-37(40)35-26-34(30-14-5-2-6-15-30)27-36(28-35)46-49-44(32-18-9-4-10-19-32)48-45(50-46)33-24-25-39-42(29-33)51-41-23-13-21-38(43(39)41)31-16-7-3-8-17-31/h2-29H |
| InChIKey | ZJDRRFJSMCZFKS-UHFFFAOYSA-N |
| XLogP | 12.32 |
| TPSA | 56.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.76 |
| LogP ≤ 5 | 12.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|