C23H16N4 — CID 161439670
2-(2-isocyanophenyl)-4-(2-methylphenyl)-6-phenyl-1,3,5-triazine (PubChem CID 161439670) has the molecular formula C23H16N4 and a molecular weight of 348.41 g/mol. Its IUPAC name is 2-(2-isocyanophenyl)-4-(2-methylphenyl)-6-phenyl-1,3,5-triazine.
| Compound Name | 2-(2-isocyanophenyl)-4-(2-methylphenyl)-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 161439670 |
| Molecular Formula | C23H16N4 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 2-(2-isocyanophenyl)-4-(2-methylphenyl)-6-phenyl-1,3,5-triazine |
| SMILES | [C-]#[N+]c1ccccc1-c1nc(-c2ccccc2)nc(-c2ccccc2C)n1 |
| InChI | InChI=1S/C23H16N4/c1-16-10-6-7-13-18(16)22-25-21(17-11-4-3-5-12-17)26-23(27-22)19-14-8-9-15-20(19)24-2/h3-15H,1H3 |
| InChIKey | DKBXUPCGNOKWPT-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 43.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|