C28H16F2N4 — CID 176615419
2-(2,4-difluoro-5-isocyano-3-phenylphenyl)-4,6-diphenyl-1,3,5-triazine (PubChem CID 176615419) has the molecular formula C28H16F2N4 and a molecular weight of 446.46 g/mol. Its IUPAC name is 2-(2,4-difluoro-5-isocyano-3-phenylphenyl)-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-(2,4-difluoro-5-isocyano-3-phenylphenyl)-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 176615419 |
| Molecular Formula | C28H16F2N4 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | 2-(2,4-difluoro-5-isocyano-3-phenylphenyl)-4,6-diphenyl-1,3,5-triazine |
| SMILES | [C-]#[N+]c1cc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c(F)c(-c2ccccc2)c1F |
| InChI | InChI=1S/C28H16F2N4/c1-31-22-17-21(24(29)23(25(22)30)18-11-5-2-6-12-18)28-33-26(19-13-7-3-8-14-19)32-27(34-28)20-15-9-4-10-16-20/h2-17H |
| InChIKey | USHPSHDKDFYABV-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 43.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|