C21H11F4N3 — CID 138569840
2,4-bis(2,4-difluorophenyl)-6-phenyl-1,3,5-triazine (PubChem CID 138569840) has the molecular formula C21H11F4N3 and a molecular weight of 381.33 g/mol. Its IUPAC name is 2,4-bis(2,4-difluorophenyl)-6-phenyl-1,3,5-triazine.
| Compound Name | 2,4-bis(2,4-difluorophenyl)-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 138569840 |
| Molecular Formula | C21H11F4N3 |
| Molecular Weight | 381.33 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 2,4-bis(2,4-difluorophenyl)-6-phenyl-1,3,5-triazine |
| SMILES | Fc1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(F)cc3F)n2)c(F)c1 |
| InChI | InChI=1S/C21H11F4N3/c22-13-6-8-15(17(24)10-13)20-26-19(12-4-2-1-3-5-12)27-21(28-20)16-9-7-14(23)11-18(16)25/h1-11H |
| InChIKey | NCTOFCMHWJVLOE-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.33 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |