C54H34F2N6 — CID 154967458
2-[5-[2-[2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-fluorophenyl]phenyl]phenyl]-2-fluorophenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 154967458) has the molecular formula C54H34F2N6 and a molecular weight of 804.90 g/mol. Its IUPAC name is 2-[5-[2-[2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-fluorophenyl]phenyl]phenyl]-2-fluorophenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[5-[2-[2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-fluorophenyl]phenyl]phenyl]-2-fluorophenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 154967458 |
| Molecular Formula | C54H34F2N6 |
| Molecular Weight | 804.90 g/mol |
| Exact Mass | 804.28 |
| IUPAC Name | 2-[5-[2-[2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-fluorophenyl]phenyl]phenyl]-2-fluorophenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | Fc1ccc(-c2ccccc2-c2ccccc2-c2ccc(F)c(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c2)cc1-c1nc(-c2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C54H34F2N6/c55-47-31-29-39(33-45(47)53-59-49(35-17-5-1-6-18-35)57-50(60-53)36-19-7-2-8-20-36)41-25-13-15-27-43(41)44-28-16-14-26-42(44)40-30-32-48(56)46(34-40)54-61-51(37-21-9-3-10-22-37)58-52(62-54)38-23-11-4-12-24-38/h1-34H |
| InChIKey | WAMNJYQXMLTXLR-UHFFFAOYSA-N |
| XLogP | 13.34 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.90 |
| LogP ≤ 5 | 13.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |