C22H13FN4 — CID 134476233
3-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-fluorobenzonitrile (PubChem CID 134476233) has the molecular formula C22H13FN4 and a molecular weight of 352.37 g/mol. Its IUPAC name is 3-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-fluorobenzonitrile.
| Compound Name | 3-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-fluorobenzonitrile |
|---|---|
| PubChem CID | 134476233 |
| Molecular Formula | C22H13FN4 |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 3-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-fluorobenzonitrile |
| SMILES | N#Cc1ccc(F)c(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C22H13FN4/c23-19-12-11-15(14-24)13-18(19)22-26-20(16-7-3-1-4-8-16)25-21(27-22)17-9-5-2-6-10-17/h1-13H |
| InChIKey | TYXJFLNLPAAJMJ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |