C29H17F2N3 — CID 138515632
3-[5-(2,6-diphenylpyrimidin-4-yl)-2-fluorophenyl]-4-fluorobenzonitrile (PubChem CID 138515632) has the molecular formula C29H17F2N3 and a molecular weight of 445.47 g/mol. Its IUPAC name is 3-[5-(2,6-diphenylpyrimidin-4-yl)-2-fluorophenyl]-4-fluorobenzonitrile.
| Compound Name | 3-[5-(2,6-diphenylpyrimidin-4-yl)-2-fluorophenyl]-4-fluorobenzonitrile |
|---|---|
| PubChem CID | 138515632 |
| Molecular Formula | C29H17F2N3 |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | 3-[5-(2,6-diphenylpyrimidin-4-yl)-2-fluorophenyl]-4-fluorobenzonitrile |
| SMILES | N#Cc1ccc(F)c(-c2cc(-c3cc(-c4ccccc4)nc(-c4ccccc4)n3)ccc2F)c1 |
| InChI | InChI=1S/C29H17F2N3/c30-25-13-11-19(18-32)15-23(25)24-16-22(12-14-26(24)31)28-17-27(20-7-3-1-4-8-20)33-29(34-28)21-9-5-2-6-10-21/h1-17H |
| InChIKey | RIUPFCPLHNYVJZ-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |