C27H18FN3 — CID 146415001
2-(2-fluoro-5-phenylphenyl)-4,6-diphenyl-1,3,5-triazine (PubChem CID 146415001) has the molecular formula C27H18FN3 and a molecular weight of 403.46 g/mol. Its IUPAC name is 2-(2-fluoro-5-phenylphenyl)-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-(2-fluoro-5-phenylphenyl)-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 146415001 |
| Molecular Formula | C27H18FN3 |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 2-(2-fluoro-5-phenylphenyl)-4,6-diphenyl-1,3,5-triazine |
| SMILES | Fc1ccc(-c2ccccc2)cc1-c1nc(-c2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C27H18FN3/c28-24-17-16-22(19-10-4-1-5-11-19)18-23(24)27-30-25(20-12-6-2-7-13-20)29-26(31-27)21-14-8-3-9-15-21/h1-18H |
| InChIKey | KEKAKEZJHVZBGK-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |