C27H19FN4 — CID 139303881
2-fluoro-5-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]aniline (PubChem CID 139303881) has the molecular formula C27H19FN4 and a molecular weight of 418.48 g/mol. Its IUPAC name is 2-fluoro-5-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]aniline.
| Compound Name | 2-fluoro-5-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]aniline |
|---|---|
| PubChem CID | 139303881 |
| Molecular Formula | C27H19FN4 |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 2-fluoro-5-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]aniline |
| SMILES | Nc1cc(-c2nc(-c3ccccc3)nc(-c3cccc(-c4ccccc4)c3)n2)ccc1F |
| InChI | InChI=1S/C27H19FN4/c28-23-15-14-22(17-24(23)29)27-31-25(19-10-5-2-6-11-19)30-26(32-27)21-13-7-12-20(16-21)18-8-3-1-4-9-18/h1-17H,29H2 |
| InChIKey | PPCCGQUXFKTXMF-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|