C69H42F2N10 — CID 138565721
9-[5-(2,4-difluorophenyl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,6-bis(4,6-diphenyl-1,3,5-triazin-2-yl)carbazole (PubChem CID 138565721) has the molecular formula C69H42F2N10 and a molecular weight of 1049.16 g/mol. Its IUPAC name is 9-[5-(2,4-difluorophenyl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,6-bis(4,6-diphenyl-1,3,5-triazin-2-yl)carbazole.
| Compound Name | 9-[5-(2,4-difluorophenyl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,6-bis(4,6-diphenyl-1,3,5-triazin-2-yl)carbazole |
|---|---|
| PubChem CID | 138565721 |
| Molecular Formula | C69H42F2N10 |
| Molecular Weight | 1049.16 g/mol |
| Exact Mass | 1048.36 |
| IUPAC Name | 9-[5-(2,4-difluorophenyl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,6-bis(4,6-diphenyl-1,3,5-triazin-2-yl)carbazole |
| SMILES | Fc1ccc(-c2ccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c(-n3c4ccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)cc4c4cc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)ccc43)c2)c(F)c1 |
| InChI | InChI=1S/C69H42F2N10/c70-52-34-36-53(57(71)42-52)49-31-35-54(69-79-65(47-27-15-5-16-28-47)74-66(80-69)48-29-17-6-18-30-48)60(41-49)81-58-37-32-50(67-75-61(43-19-7-1-8-20-43)72-62(76-67)44-21-9-2-10-22-44)39-55(58)56-40-51(33-38-59(56)81)68-77-63(45-23-11-3-12-24-45)73-64(78-68)46-25-13-4-14-26-46/h1-42H |
| InChIKey | SMCLSQFFKPJXPX-UHFFFAOYSA-N |
| XLogP | 16.29 |
| TPSA | 120.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 81 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1049.16 |
| LogP ≤ 5 | 16.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |