C53H37FN4 — CID 138549712
9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-(3-fluorophenyl)phenyl]-3,6-bis(3-methylphenyl)carbazole (PubChem CID 138549712) has the molecular formula C53H37FN4 and a molecular weight of 748.91 g/mol. Its IUPAC name is 9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-(3-fluorophenyl)phenyl]-3,6-bis(3-methylphenyl)carbazole.
| Compound Name | 9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-(3-fluorophenyl)phenyl]-3,6-bis(3-methylphenyl)carbazole |
|---|---|
| PubChem CID | 138549712 |
| Molecular Formula | C53H37FN4 |
| Molecular Weight | 748.91 g/mol |
| Exact Mass | 748.30 |
| IUPAC Name | 9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-(3-fluorophenyl)phenyl]-3,6-bis(3-methylphenyl)carbazole |
| SMILES | Cc1cccc(-c2ccc3c(c2)c2cc(-c4cccc(C)c4)ccc2n3-c2cc(-c3cccc(F)c3)ccc2-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C53H37FN4/c1-34-12-9-18-38(28-34)41-23-26-48-46(31-41)47-32-42(39-19-10-13-35(2)29-39)24-27-49(47)58(48)50-33-43(40-20-11-21-44(54)30-40)22-25-45(50)53-56-51(36-14-5-3-6-15-36)55-52(57-53)37-16-7-4-8-17-37/h3-33H,1-2H3 |
| InChIKey | VIAAWJJJFKLCLD-UHFFFAOYSA-N |
| XLogP | 13.73 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.91 |
| LogP ≤ 5 | 13.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |