C20H12F2N4 — CID 167227635
2-(2,6-difluoro-3-pyridinyl)-4,6-diphenyl-1,3,5-triazine (PubChem CID 167227635) has the molecular formula C20H12F2N4 and a molecular weight of 346.34 g/mol. Its IUPAC name is 2-(2,6-difluoro-3-pyridinyl)-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-(2,6-difluoro-3-pyridinyl)-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 167227635 |
| Molecular Formula | C20H12F2N4 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 2-(2,6-difluoro-3-pyridinyl)-4,6-diphenyl-1,3,5-triazine |
| SMILES | Fc1ccc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c(F)n1 |
| InChI | InChI=1S/C20H12F2N4/c21-16-12-11-15(17(22)23-16)20-25-18(13-7-3-1-4-8-13)24-19(26-20)14-9-5-2-6-10-14/h1-12H |
| InChIKey | OFNWBIBAKHCWQG-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|