C22H16FN3 — CID 138579162
2-(3-fluoro-2-methylphenyl)-4,6-diphenyl-1,3,5-triazine (PubChem CID 138579162) has the molecular formula C22H16FN3 and a molecular weight of 341.39 g/mol. Its IUPAC name is 2-(3-fluoro-2-methylphenyl)-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-(3-fluoro-2-methylphenyl)-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 138579162 |
| Molecular Formula | C22H16FN3 |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 2-(3-fluoro-2-methylphenyl)-4,6-diphenyl-1,3,5-triazine |
| SMILES | Cc1c(F)cccc1-c1nc(-c2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C22H16FN3/c1-15-18(13-8-14-19(15)23)22-25-20(16-9-4-2-5-10-16)24-21(26-22)17-11-6-3-7-12-17/h2-14H,1H3 |
| InChIKey | OZTYQSPQVWYLDP-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |