C28H25FN4 — CID 142560199
N-[(1Z)-buta-1,3-dienyl]ethanimine;2-(3-fluoro-2-methylphenyl)-4,6-diphenyl-1,3,5-triazine (PubChem CID 142560199) has the molecular formula C28H25FN4 and a molecular weight of 436.53 g/mol. Its IUPAC name is N-[(1Z)-buta-1,3-dienyl]ethanimine;2-(3-fluoro-2-methylphenyl)-4,6-diphenyl-1,3,5-triazine.
| Compound Name | N-[(1Z)-buta-1,3-dienyl]ethanimine;2-(3-fluoro-2-methylphenyl)-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 142560199 |
| Molecular Formula | C28H25FN4 |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | N-[(1Z)-buta-1,3-dienyl]ethanimine;2-(3-fluoro-2-methylphenyl)-4,6-diphenyl-1,3,5-triazine |
| SMILES | C=C/C=C\N=C\C.Cc1c(F)cccc1-c1nc(-c2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C22H16FN3.C6H9N/c1-15-18(13-8-14-19(15)23)22-25-20(16-9-4-2-5-10-16)24-21(26-22)17-11-6-3-7-12-17;1-3-5-6-7-4-2/h2-14H,1H3;3-6H,1H2,2H3/b;6-5-,7-4+ |
| InChIKey | PPTNVXDOVRRHEW-UUTYJRQOSA-N |
| XLogP | 7.10 |
| TPSA | 51.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|