C42H28N6O — CID 138671668
2-[2-[(1Z)-buta-1,3-dienyl]-3-(4,6-diphenyl-1,3,5-triazin-2-yl)-1-benzofuran-4-yl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 138671668) has the molecular formula C42H28N6O and a molecular weight of 632.73 g/mol. Its IUPAC name is 2-[2-[(1Z)-buta-1,3-dienyl]-3-(4,6-diphenyl-1,3,5-triazin-2-yl)-1-benzofuran-4-yl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[2-[(1Z)-buta-1,3-dienyl]-3-(4,6-diphenyl-1,3,5-triazin-2-yl)-1-benzofuran-4-yl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 138671668 |
| Molecular Formula | C42H28N6O |
| Molecular Weight | 632.73 g/mol |
| Exact Mass | 632.23 |
| IUPAC Name | 2-[2-[(1Z)-buta-1,3-dienyl]-3-(4,6-diphenyl-1,3,5-triazin-2-yl)-1-benzofuran-4-yl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | C=C/C=C\c1oc2cccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c2c1-c1nc(-c2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C42H28N6O/c1-2-3-26-34-36(42-47-39(30-21-12-6-13-22-30)44-40(48-42)31-23-14-7-15-24-31)35-32(25-16-27-33(35)49-34)41-45-37(28-17-8-4-9-18-28)43-38(46-41)29-19-10-5-11-20-29/h2-27H,1H2/b26-3- |
| InChIKey | PKFKRXZFGMGGBS-JZDBNNKSSA-N |
| XLogP | 10.00 |
| TPSA | 90.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.73 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|