C43H27N5O2 — CID 162457178
2-[6-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-1-yl]-4-[(1E,3Z)-hexa-1,3,5-trienyl]-[1]benzofuro[3,2-d]pyrimidine (PubChem CID 162457178) has the molecular formula C43H27N5O2 and a molecular weight of 645.72 g/mol. Its IUPAC name is 2-[6-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-1-yl]-4-[(1E,3Z)-hexa-1,3,5-trienyl]-[1]benzofuro[3,2-d]pyrimidine.
| Compound Name | 2-[6-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-1-yl]-4-[(1E,3Z)-hexa-1,3,5-trienyl]-[1]benzofuro[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 162457178 |
| Molecular Formula | C43H27N5O2 |
| Molecular Weight | 645.72 g/mol |
| Exact Mass | 645.22 |
| IUPAC Name | 2-[6-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-1-yl]-4-[(1E,3Z)-hexa-1,3,5-trienyl]-[1]benzofuro[3,2-d]pyrimidine |
| SMILES | C=C/C=C\C=C\c1nc(-c2cccc3oc4c(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)cccc4c23)nc2c1oc1ccccc12 |
| InChI | InChI=1S/C43H27N5O2/c1-2-3-4-11-24-33-39-37(29-20-12-13-25-34(29)49-39)45-42(44-33)31-22-15-26-35-36(31)30-21-14-23-32(38(30)50-35)43-47-40(27-16-7-5-8-17-27)46-41(48-43)28-18-9-6-10-19-28/h2-26H,1H2/b4-3-,24-11+ |
| InChIKey | DUMGPGGRPPENKO-FEFYROFESA-N |
| XLogP | 10.88 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.72 |
| LogP ≤ 5 | 10.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|