C50H30N6OS — CID 155050246
3-[4-[4-[6-[4-[(1E,3Z)-hexa-1,3,5-trienyl]-[1]benzothiolo[3,2-d]pyrimidin-2-yl]dibenzofuran-1-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]benzonitrile (PubChem CID 155050246) has the molecular formula C50H30N6OS and a molecular weight of 762.90 g/mol. Its IUPAC name is 3-[4-[4-[6-[4-[(1E,3Z)-hexa-1,3,5-trienyl]-[1]benzothiolo[3,2-d]pyrimidin-2-yl]dibenzofuran-1-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]benzonitrile.
| Compound Name | 3-[4-[4-[6-[4-[(1E,3Z)-hexa-1,3,5-trienyl]-[1]benzothiolo[3,2-d]pyrimidin-2-yl]dibenzofuran-1-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 155050246 |
| Molecular Formula | C50H30N6OS |
| Molecular Weight | 762.90 g/mol |
| Exact Mass | 762.22 |
| IUPAC Name | 3-[4-[4-[6-[4-[(1E,3Z)-hexa-1,3,5-trienyl]-[1]benzothiolo[3,2-d]pyrimidin-2-yl]dibenzofuran-1-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]benzonitrile |
| SMILES | C=C/C=C\C=C\c1nc(-c2cccc3c2oc2cccc(-c4nc(-c5ccccc5)nc(-c5ccc(-c6cccc(C#N)c6)cc5)n4)c23)nc2c1sc1ccccc12 |
| InChI | InChI=1S/C50H30N6OS/c1-2-3-4-8-22-40-46-44(36-18-9-10-24-42(36)58-46)53-50(52-40)39-21-12-19-37-43-38(20-13-23-41(43)57-45(37)39)49-55-47(33-15-6-5-7-16-33)54-48(56-49)34-27-25-32(26-28-34)35-17-11-14-31(29-35)30-51/h2-29H,1H2/b4-3-,22-8+ |
| InChIKey | DNZUEGLVIJVRIM-CYFYPPFASA-N |
| XLogP | 12.89 |
| TPSA | 101.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.90 |
| LogP ≤ 5 | 12.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|