C49H31N7 — CID 158728702
2-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-4-(2-isocyanophenyl)-6-(4-phenylphenyl)-1,3,5-triazine (PubChem CID 158728702) has the molecular formula C49H31N7 and a molecular weight of 717.84 g/mol. Its IUPAC name is 2-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-4-(2-isocyanophenyl)-6-(4-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-4-(2-isocyanophenyl)-6-(4-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 158728702 |
| Molecular Formula | C49H31N7 |
| Molecular Weight | 717.84 g/mol |
| Exact Mass | 717.26 |
| IUPAC Name | 2-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-4-(2-isocyanophenyl)-6-(4-phenylphenyl)-1,3,5-triazine |
| SMILES | [C-]#[N+]c1ccccc1-c1nc(-c2ccc(-c3ccccc3)cc2)nc(-c2cccc(-c3cccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3)c2)n1 |
| InChI | InChI=1S/C49H31N7/c1-50-43-26-12-11-25-42(43)49-55-46(37-29-27-34(28-30-37)33-15-5-2-6-16-33)54-48(56-49)41-24-14-22-39(32-41)38-21-13-23-40(31-38)47-52-44(35-17-7-3-8-18-35)51-45(53-47)36-19-9-4-10-20-36/h2-32H |
| InChIKey | GJZMVUMQMQNMMP-UHFFFAOYSA-N |
| XLogP | 11.94 |
| TPSA | 81.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.84 |
| LogP ≤ 5 | 11.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|