C59H35B2N5 — CID 153499990
2,4-bis(14-boratetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),2,4,6,8,10,12,15,17-nonaen-14-yl)-3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-isocyanobenzonitrile (PubChem CID 153499990) has the molecular formula C59H35B2N5 and a molecular weight of 835.59 g/mol. Its IUPAC name is 2,4-bis(14-boratetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),2,4,6,8,10,12,15,17-nonaen-14-yl)-3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-isocyanobenzonitrile.
| Compound Name | 2,4-bis(14-boratetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),2,4,6,8,10,12,15,17-nonaen-14-yl)-3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-isocyanobenzonitrile |
|---|---|
| PubChem CID | 153499990 |
| Molecular Formula | C59H35B2N5 |
| Molecular Weight | 835.59 g/mol |
| Exact Mass | 835.31 |
| IUPAC Name | 2,4-bis(14-boratetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),2,4,6,8,10,12,15,17-nonaen-14-yl)-3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1cc(C#N)c(B2c3ccccc3-c3ccccc3-c3ccccc32)c(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c1B1c2ccccc2-c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C59H35B2N5/c1-63-53-36-40(37-62)55(60-49-32-16-12-28-45(49)41-24-8-9-25-42(41)46-29-13-17-33-50(46)60)54(59-65-57(38-20-4-2-5-21-38)64-58(66-59)39-22-6-3-7-23-39)56(53)61-51-34-18-14-30-47(51)43-26-10-11-27-44(43)48-31-15-19-35-52(48)61/h2-36H |
| InChIKey | DOXYSOSEEXQLMB-UHFFFAOYSA-N |
| XLogP | 9.62 |
| TPSA | 66.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 835.59 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|