C34H22N4 — CID 168837004
2-[4-(3,5-diphenylphenyl)-6-phenyl-1,3,5-triazin-2-yl]benzonitrile (PubChem CID 168837004) has the molecular formula C34H22N4 and a molecular weight of 486.58 g/mol. Its IUPAC name is 2-[4-(3,5-diphenylphenyl)-6-phenyl-1,3,5-triazin-2-yl]benzonitrile.
| Compound Name | 2-[4-(3,5-diphenylphenyl)-6-phenyl-1,3,5-triazin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 168837004 |
| Molecular Formula | C34H22N4 |
| Molecular Weight | 486.58 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | 2-[4-(3,5-diphenylphenyl)-6-phenyl-1,3,5-triazin-2-yl]benzonitrile |
| SMILES | N#Cc1ccccc1-c1nc(-c2ccccc2)nc(-c2cc(-c3ccccc3)cc(-c3ccccc3)c2)n1 |
| InChI | InChI=1S/C34H22N4/c35-23-27-18-10-11-19-31(27)34-37-32(26-16-8-3-9-17-26)36-33(38-34)30-21-28(24-12-4-1-5-13-24)20-29(22-30)25-14-6-2-7-15-25/h1-22H |
| InChIKey | VDALIWODMSDFPY-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.58 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |