C16H11N5 — CID 118979887
2-(4-amino-6-phenyl-1,3,5-triazin-2-yl)benzonitrile (PubChem CID 118979887) has the molecular formula C16H11N5 and a molecular weight of 273.30 g/mol. Its IUPAC name is 2-(4-amino-6-phenyl-1,3,5-triazin-2-yl)benzonitrile.
| Compound Name | 2-(4-amino-6-phenyl-1,3,5-triazin-2-yl)benzonitrile |
|---|---|
| PubChem CID | 118979887 |
| Molecular Formula | C16H11N5 |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 2-(4-amino-6-phenyl-1,3,5-triazin-2-yl)benzonitrile |
| SMILES | N#Cc1ccccc1-c1nc(N)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C16H11N5/c17-10-12-8-4-5-9-13(12)15-19-14(20-16(18)21-15)11-6-2-1-3-7-11/h1-9H,(H2,18,19,20,21) |
| InChIKey | PLJPEOJJCHJLGF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |