C27H20N4 — CID 22352251
4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-amine (PubChem CID 22352251) has the molecular formula C27H20N4 and a molecular weight of 400.49 g/mol. Its IUPAC name is 4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-amine.
| Compound Name | 4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 22352251 |
| Molecular Formula | C27H20N4 |
| Molecular Weight | 400.49 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-amine |
| SMILES | Nc1nc(-c2ccc(-c3ccccc3)cc2)nc(-c2ccc(-c3ccccc3)cc2)n1 |
| InChI | InChI=1S/C27H20N4/c28-27-30-25(23-15-11-21(12-16-23)19-7-3-1-4-8-19)29-26(31-27)24-17-13-22(14-18-24)20-9-5-2-6-10-20/h1-18H,(H2,28,29,30,31) |
| InChIKey | CMLNJQVEJXAEFB-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.49 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |