C10H13N7S — CID 87330411
6-phenyl-1,3,5-triazine-2,4-diamine;thiourea (PubChem CID 87330411) has the molecular formula C10H13N7S and a molecular weight of 263.33 g/mol. Its IUPAC name is 6-phenyl-1,3,5-triazine-2,4-diamine;thiourea.
| Compound Name | 6-phenyl-1,3,5-triazine-2,4-diamine;thiourea |
|---|---|
| PubChem CID | 87330411 |
| Molecular Formula | C10H13N7S |
| Molecular Weight | 263.33 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 6-phenyl-1,3,5-triazine-2,4-diamine;thiourea |
| SMILES | NC(N)=S.Nc1nc(N)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C9H9N5.CH4N2S/c10-8-12-7(13-9(11)14-8)6-4-2-1-3-5-6;2-1(3)4/h1-5H,(H4,10,11,12,13,14);(H4,2,3,4) |
| InChIKey | AZABOHLXXGPBEP-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.33 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|