About 2-(4-amino-6-phenyl-1,3,5-triazin-2-yl)acetic acid
2-(4-amino-6-phenyl-1,3,5-triazin-2-yl)acetic acid (PubChem CID 68852154) has the molecular formula C11H10N4O2
and a molecular weight of 230.23 g/mol. Its IUPAC name is 2-(4-amino-6-phenyl-1,3,5-triazin-2-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(4-amino-6-phenyl-1,3,5-triazin-2-yl)acetic acid |
| PubChem CID | 68852154 |
| Molecular Formula | C11H10N4O2 |
| Molecular Weight | 230.23 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 2-(4-amino-6-phenyl-1,3,5-triazin-2-yl)acetic acid |
| SMILES | Nc1nc(CC(=O)O)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C11H10N4O2/c12-11-14-8(6-9(16)17)13-10(15-11)7-4-2-1-3-5-7/h1-5H,6H2,(H,16,17)(H2,12,13,14,15) |
| InChIKey | PSAZNSUNKDZMNX-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 101.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.23 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4-amino-6-phenyl-1,3,5-triazin-2-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-amino-6-phenyl-1,3,5-triazin-2-yl)acetic acid?
The IUPAC name of 2-(4-amino-6-phenyl-1,3,5-triazin-2-yl)acetic acid (CID 68852154) is 2-(4-amino-6-phenyl-1,3,5-triazin-2-yl)acetic acid.
What is the SMILES notation for 2-(4-amino-6-phenyl-1,3,5-triazin-2-yl)acetic acid?
The canonical SMILES for 2-(4-amino-6-phenyl-1,3,5-triazin-2-yl)acetic acid is Nc1nc(CC(=O)O)nc(-c2ccccc2)n1.
What is the InChIKey of 2-(4-amino-6-phenyl-1,3,5-triazin-2-yl)acetic acid?
The InChIKey is PSAZNSUNKDZMNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N4O2/c12-11-14-8(6-9(16)17)13-10(15-11)7-4-2-1-3-5-7/h1-5H,6H2,(H,16,17)(H2,12,13,14,15).
What are the key properties of 2-(4-amino-6-phenyl-1,3,5-triazin-2-yl)acetic acid?
2-(4-amino-6-phenyl-1,3,5-triazin-2-yl)acetic acid has a molecular weight of 230.23 g/mol, XLogP of 0.75, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-amino-6-phenyl-1,3,5-triazin-2-yl)acetic acid is sourced from PubChem (CID 68852154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).