C12H14N4 — CID 63868472
4-phenyl-6-propan-2-yl-1,3,5-triazin-2-amine (PubChem CID 63868472) has the molecular formula C12H14N4 and a molecular weight of 214.27 g/mol. Its IUPAC name is 4-phenyl-6-propan-2-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-phenyl-6-propan-2-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 63868472 |
| Molecular Formula | C12H14N4 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 4-phenyl-6-propan-2-yl-1,3,5-triazin-2-amine |
| SMILES | CC(C)c1nc(N)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C12H14N4/c1-8(2)10-14-11(16-12(13)15-10)9-6-4-3-5-7-9/h3-8H,1-2H3,(H2,13,14,15,16) |
| InChIKey | HEGPBOZOOIGWLD-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |