C39H41N9 — CID 176842994
2,4-bis[3-[4,6-di(propan-2-yl)-1,3,5-triazin-2-yl]phenyl]-6-phenyl-1,3,5-triazine (PubChem CID 176842994) has the molecular formula C39H41N9 and a molecular weight of 635.82 g/mol. Its IUPAC name is 2,4-bis[3-[4,6-di(propan-2-yl)-1,3,5-triazin-2-yl]phenyl]-6-phenyl-1,3,5-triazine.
| Compound Name | 2,4-bis[3-[4,6-di(propan-2-yl)-1,3,5-triazin-2-yl]phenyl]-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 176842994 |
| Molecular Formula | C39H41N9 |
| Molecular Weight | 635.82 g/mol |
| Exact Mass | 635.35 |
| IUPAC Name | 2,4-bis[3-[4,6-di(propan-2-yl)-1,3,5-triazin-2-yl]phenyl]-6-phenyl-1,3,5-triazine |
| SMILES | CC(C)c1nc(-c2cccc(-c3nc(-c4ccccc4)nc(-c4cccc(-c5nc(C(C)C)nc(C(C)C)n5)c4)n3)c2)nc(C(C)C)n1 |
| InChI | InChI=1S/C39H41N9/c1-22(2)31-40-32(23(3)4)43-36(42-31)27-16-12-18-29(20-27)38-46-35(26-14-10-9-11-15-26)47-39(48-38)30-19-13-17-28(21-30)37-44-33(24(5)6)41-34(45-37)25(7)8/h9-25H,1-8H3 |
| InChIKey | FKDWLIMRFASSGQ-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 116.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.82 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |