C48H35N9 — CID 176843198
2,4-diphenyl-6-[4-[4-phenyl-6-[3-(4-phenyl-6-propan-2-yl-1,3,5-triazin-2-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]-1,3,5-triazine (PubChem CID 176843198) has the molecular formula C48H35N9 and a molecular weight of 737.87 g/mol. Its IUPAC name is 2,4-diphenyl-6-[4-[4-phenyl-6-[3-(4-phenyl-6-propan-2-yl-1,3,5-triazin-2-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]-1,3,5-triazine.
| Compound Name | 2,4-diphenyl-6-[4-[4-phenyl-6-[3-(4-phenyl-6-propan-2-yl-1,3,5-triazin-2-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 176843198 |
| Molecular Formula | C48H35N9 |
| Molecular Weight | 737.87 g/mol |
| Exact Mass | 737.30 |
| IUPAC Name | 2,4-diphenyl-6-[4-[4-phenyl-6-[3-(4-phenyl-6-propan-2-yl-1,3,5-triazin-2-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]-1,3,5-triazine |
| SMILES | CC(C)c1nc(-c2ccccc2)nc(-c2cccc(-c3nc(-c4ccccc4)nc(-c4ccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)cc4)n3)c2)n1 |
| InChI | InChI=1S/C48H35N9/c1-31(2)40-49-41(32-16-7-3-8-17-32)55-47(50-40)38-24-15-25-39(30-38)48-56-44(35-22-13-6-14-23-35)54-46(57-48)37-28-26-36(27-29-37)45-52-42(33-18-9-4-10-19-33)51-43(53-45)34-20-11-5-12-21-34/h3-31H,1-2H3 |
| InChIKey | NGEXGIIRUAKMFO-UHFFFAOYSA-N |
| XLogP | 10.70 |
| TPSA | 116.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.87 |
| LogP ≤ 5 | 10.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |