C50H40N10 — CID 176843141
2-[3-[4-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-pyridin-4-ylphenyl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]-4,6-di(propan-2-yl)-1,3,5-triazine (PubChem CID 176843141) has the molecular formula C50H40N10 and a molecular weight of 780.94 g/mol. Its IUPAC name is 2-[3-[4-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-pyridin-4-ylphenyl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]-4,6-di(propan-2-yl)-1,3,5-triazine.
| Compound Name | 2-[3-[4-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-pyridin-4-ylphenyl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]-4,6-di(propan-2-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 176843141 |
| Molecular Formula | C50H40N10 |
| Molecular Weight | 780.94 g/mol |
| Exact Mass | 780.34 |
| IUPAC Name | 2-[3-[4-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-pyridin-4-ylphenyl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]-4,6-di(propan-2-yl)-1,3,5-triazine |
| SMILES | CC(C)c1nc(-c2cccc(-c3nc(-c4ccccc4)nc(-c4cc(-c5ccncc5)cc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)c4)n3)c2)nc(C(C)C)n1 |
| InChI | InChI=1S/C50H40N10/c1-31(2)42-52-43(32(3)4)54-47(53-42)37-21-14-22-38(27-37)48-56-46(36-19-12-7-13-20-36)59-50(60-48)41-29-39(33-23-25-51-26-24-33)28-40(30-41)49-57-44(34-15-8-5-9-16-34)55-45(58-49)35-17-10-6-11-18-35/h5-32H,1-4H3 |
| InChIKey | DIYJBXIECOJOEV-UHFFFAOYSA-N |
| XLogP | 11.22 |
| TPSA | 128.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.94 |
| LogP ≤ 5 | 11.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |