C39H42N10 — CID 176842945
2-[3-[4,6-di(propan-2-yl)-1,3,5-triazin-2-yl]phenyl]-4-[3-(4-methyl-6-propan-2-yl-1,3,5-triazin-2-yl)-5-pyridin-4-ylphenyl]-6-propan-2-yl-1,3,5-triazine (PubChem CID 176842945) has the molecular formula C39H42N10 and a molecular weight of 650.84 g/mol. Its IUPAC name is 2-[3-[4,6-di(propan-2-yl)-1,3,5-triazin-2-yl]phenyl]-4-[3-(4-methyl-6-propan-2-yl-1,3,5-triazin-2-yl)-5-pyridin-4-ylphenyl]-6-propan-2-yl-1,3,5-triazine.
| Compound Name | 2-[3-[4,6-di(propan-2-yl)-1,3,5-triazin-2-yl]phenyl]-4-[3-(4-methyl-6-propan-2-yl-1,3,5-triazin-2-yl)-5-pyridin-4-ylphenyl]-6-propan-2-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 176842945 |
| Molecular Formula | C39H42N10 |
| Molecular Weight | 650.84 g/mol |
| Exact Mass | 650.36 |
| IUPAC Name | 2-[3-[4,6-di(propan-2-yl)-1,3,5-triazin-2-yl]phenyl]-4-[3-(4-methyl-6-propan-2-yl-1,3,5-triazin-2-yl)-5-pyridin-4-ylphenyl]-6-propan-2-yl-1,3,5-triazine |
| SMILES | Cc1nc(-c2cc(-c3ccncc3)cc(-c3nc(-c4cccc(-c5nc(C(C)C)nc(C(C)C)n5)c4)nc(C(C)C)n3)c2)nc(C(C)C)n1 |
| InChI | InChI=1S/C39H42N10/c1-21(2)32-41-25(9)42-38(44-32)30-18-29(26-13-15-40-16-14-26)19-31(20-30)39-48-35(24(7)8)47-37(49-39)28-12-10-11-27(17-28)36-45-33(22(3)4)43-34(46-36)23(5)6/h10-24H,1-9H3 |
| InChIKey | JRHMDBKFFVFCCO-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 128.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.84 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |