C16H22N4O — CID 116734103
4-(1-ethoxy-2,2-dimethylpropyl)-6-phenyl-1,3,5-triazin-2-amine (PubChem CID 116734103) has the molecular formula C16H22N4O and a molecular weight of 286.38 g/mol. Its IUPAC name is 4-(1-ethoxy-2,2-dimethylpropyl)-6-phenyl-1,3,5-triazin-2-amine.
| Compound Name | 4-(1-ethoxy-2,2-dimethylpropyl)-6-phenyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 116734103 |
| Molecular Formula | C16H22N4O |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | 4-(1-ethoxy-2,2-dimethylpropyl)-6-phenyl-1,3,5-triazin-2-amine |
| SMILES | CCOC(c1nc(N)nc(-c2ccccc2)n1)C(C)(C)C |
| InChI | InChI=1S/C16H22N4O/c1-5-21-12(16(2,3)4)14-18-13(19-15(17)20-14)11-9-7-6-8-10-11/h6-10,12H,5H2,1-4H3,(H2,17,18,19,20) |
| InChIKey | LTUWTNYIEGJZHU-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |