3-(4,6-diamino-1,3,5-triazin-2-yl)benzoic acid

C10H9N5O2 — CID 139724485

IUPAC3-(4,6-diamino-1,3,5-triazin-2-yl)benzoic acid
SMILESNc1nc(N)nc(-c2cccc(C(=O)O)c2)n1
InChIInChI=1S/C10H9N5O2/c11-9-13-7(14-10(12)15-9)5-2-1-3-6(4-5)8(16)17/h1-4H,(H,16,17)(H4,11,12,13,14,15)
InChIKeyDLGVNGMLRIVWQR-UHFFFAOYSA-N
MW231.22 g/mol
LogP0.40
Rot. Bonds2

About 3-(4,6-diamino-1,3,5-triazin-2-yl)benzoic acid

3-(4,6-diamino-1,3,5-triazin-2-yl)benzoic acid (PubChem CID 139724485) has the molecular formula C10H9N5O2 and a molecular weight of 231.22 g/mol. Its IUPAC name is 3-(4,6-diamino-1,3,5-triazin-2-yl)benzoic acid.

Molecular Properties

Compound Name3-(4,6-diamino-1,3,5-triazin-2-yl)benzoic acid
PubChem CID139724485
Molecular FormulaC10H9N5O2
Molecular Weight231.22 g/mol
Exact Mass231.08
IUPAC Name3-(4,6-diamino-1,3,5-triazin-2-yl)benzoic acid
SMILESNc1nc(N)nc(-c2cccc(C(=O)O)c2)n1
InChIInChI=1S/C10H9N5O2/c11-9-13-7(14-10(12)15-9)5-2-1-3-6(4-5)8(16)17/h1-4H,(H,16,17)(H4,11,12,13,14,15)
InChIKeyDLGVNGMLRIVWQR-UHFFFAOYSA-N
XLogP0.40
TPSA128.01 Ų
H-Bond Donors3
H-Bond Acceptors6
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500231.22
LogP ≤ 50.40
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 106

Analyze 3-(4,6-diamino-1,3,5-triazin-2-yl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(4,6-diamino-1,3,5-triazin-2-yl)benzoic acid?
The IUPAC name of 3-(4,6-diamino-1,3,5-triazin-2-yl)benzoic acid (CID 139724485) is 3-(4,6-diamino-1,3,5-triazin-2-yl)benzoic acid.
What is the SMILES notation for 3-(4,6-diamino-1,3,5-triazin-2-yl)benzoic acid?
The canonical SMILES for 3-(4,6-diamino-1,3,5-triazin-2-yl)benzoic acid is Nc1nc(N)nc(-c2cccc(C(=O)O)c2)n1.
What is the InChIKey of 3-(4,6-diamino-1,3,5-triazin-2-yl)benzoic acid?
The InChIKey is DLGVNGMLRIVWQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N5O2/c11-9-13-7(14-10(12)15-9)5-2-1-3-6(4-5)8(16)17/h1-4H,(H,16,17)(H4,11,12,13,14,15).
What are the key properties of 3-(4,6-diamino-1,3,5-triazin-2-yl)benzoic acid?
3-(4,6-diamino-1,3,5-triazin-2-yl)benzoic acid has a molecular weight of 231.22 g/mol, XLogP of 0.40, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,6-diamino-1,3,5-triazin-2-yl)benzoic acid is sourced from PubChem (CID 139724485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).