C10H9N5O2 — CID 139724485
3-(4,6-diamino-1,3,5-triazin-2-yl)benzoic acid (PubChem CID 139724485) has the molecular formula C10H9N5O2 and a molecular weight of 231.22 g/mol. Its IUPAC name is 3-(4,6-diamino-1,3,5-triazin-2-yl)benzoic acid.
| Compound Name | 3-(4,6-diamino-1,3,5-triazin-2-yl)benzoic acid |
|---|---|
| PubChem CID | 139724485 |
| Molecular Formula | C10H9N5O2 |
| Molecular Weight | 231.22 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 3-(4,6-diamino-1,3,5-triazin-2-yl)benzoic acid |
| SMILES | Nc1nc(N)nc(-c2cccc(C(=O)O)c2)n1 |
| InChI | InChI=1S/C10H9N5O2/c11-9-13-7(14-10(12)15-9)5-2-1-3-6(4-5)8(16)17/h1-4H,(H,16,17)(H4,11,12,13,14,15) |
| InChIKey | DLGVNGMLRIVWQR-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 128.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.22 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |