C34H28N12O2 — CID 165087164
1-[3-(4,6-diamino-1,3,5-triazin-2-yl)phenyl]-2-[4-[[4-[2-[3-(4,6-diamino-1,3,5-triazin-2-yl)phenyl]-2-oxoethyl]phenyl]diazenyl]phenyl]ethanone (PubChem CID 165087164) has the molecular formula C34H28N12O2 and a molecular weight of 636.68 g/mol. Its IUPAC name is 1-[3-(4,6-diamino-1,3,5-triazin-2-yl)phenyl]-2-[4-[[4-[2-[3-(4,6-diamino-1,3,5-triazin-2-yl)phenyl]-2-oxoethyl]phenyl]diazenyl]phenyl]ethanone.
| Compound Name | 1-[3-(4,6-diamino-1,3,5-triazin-2-yl)phenyl]-2-[4-[[4-[2-[3-(4,6-diamino-1,3,5-triazin-2-yl)phenyl]-2-oxoethyl]phenyl]diazenyl]phenyl]ethanone |
|---|---|
| PubChem CID | 165087164 |
| Molecular Formula | C34H28N12O2 |
| Molecular Weight | 636.68 g/mol |
| Exact Mass | 636.25 |
| IUPAC Name | 1-[3-(4,6-diamino-1,3,5-triazin-2-yl)phenyl]-2-[4-[[4-[2-[3-(4,6-diamino-1,3,5-triazin-2-yl)phenyl]-2-oxoethyl]phenyl]diazenyl]phenyl]ethanone |
| SMILES | Nc1nc(N)nc(-c2cccc(C(=O)Cc3ccc(/N=N/c4ccc(CC(=O)c5cccc(-c6nc(N)nc(N)n6)c5)cc4)cc3)c2)n1 |
| InChI | InChI=1S/C34H28N12O2/c35-31-39-29(40-32(36)43-31)23-5-1-3-21(17-23)27(47)15-19-7-11-25(12-8-19)45-46-26-13-9-20(10-14-26)16-28(48)22-4-2-6-24(18-22)30-41-33(37)44-34(38)42-30/h1-14,17-18H,15-16H2,(H4,35,36,39,40,43)(H4,37,38,41,42,44)/b46-45+ |
| InChIKey | MQORPDYJNYAWDL-XVIFHXHVSA-N |
| XLogP | 4.99 |
| TPSA | 240.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.68 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|