C19H16ClN5O2 — CID 126649685
3-[[2,6-diamino-3-[(4-chlorophenyl)diazenyl]-4-pyridinyl]methyl]benzoic acid (PubChem CID 126649685) has the molecular formula C19H16ClN5O2 and a molecular weight of 381.82 g/mol. Its IUPAC name is 3-[[2,6-diamino-3-[(4-chlorophenyl)diazenyl]-4-pyridinyl]methyl]benzoic acid.
| Compound Name | 3-[[2,6-diamino-3-[(4-chlorophenyl)diazenyl]-4-pyridinyl]methyl]benzoic acid |
|---|---|
| PubChem CID | 126649685 |
| Molecular Formula | C19H16ClN5O2 |
| Molecular Weight | 381.82 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 3-[[2,6-diamino-3-[(4-chlorophenyl)diazenyl]-4-pyridinyl]methyl]benzoic acid |
| SMILES | Nc1cc(Cc2cccc(C(=O)O)c2)c(/N=N/c2ccc(Cl)cc2)c(N)n1 |
| InChI | InChI=1S/C19H16ClN5O2/c20-14-4-6-15(7-5-14)24-25-17-13(10-16(21)23-18(17)22)9-11-2-1-3-12(8-11)19(26)27/h1-8,10H,9H2,(H,26,27)(H4,21,22,23)/b25-24+ |
| InChIKey | RAHPHEJQHHAOBZ-OCOZRVBESA-N |
| XLogP | 4.60 |
| TPSA | 126.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.82 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|