C11H12N6O2 — CID 1494767
3-[(3,5-diamino-1-methylpyrazol-4-yl)diazenyl]benzoic acid (PubChem CID 1494767) has the molecular formula C11H12N6O2 and a molecular weight of 260.26 g/mol. Its IUPAC name is 3-[(3,5-diamino-1-methylpyrazol-4-yl)diazenyl]benzoic acid.
| Compound Name | 3-[(3,5-diamino-1-methylpyrazol-4-yl)diazenyl]benzoic acid |
|---|---|
| PubChem CID | 1494767 |
| Molecular Formula | C11H12N6O2 |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 3-[(3,5-diamino-1-methylpyrazol-4-yl)diazenyl]benzoic acid |
| SMILES | Cn1nc(N)c(/N=N/c2cccc(C(=O)O)c2)c1N |
| InChI | InChI=1S/C11H12N6O2/c1-17-10(13)8(9(12)16-17)15-14-7-4-2-3-6(5-7)11(18)19/h2-5H,13H2,1H3,(H2,12,16)(H,18,19)/b15-14+ |
| InChIKey | GGRYSRRVQZYAFM-CCEZHUSRSA-N |
| XLogP | 1.70 |
| TPSA | 131.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|