C16H11N3O5 — CID 135924021
3-[(3-carboxyphenyl)diazenyl]-2-hydroxy-1H-indole-5-carboxylic acid (PubChem CID 135924021) has the molecular formula C16H11N3O5 and a molecular weight of 325.28 g/mol. Its IUPAC name is 3-[(3-carboxyphenyl)diazenyl]-2-hydroxy-1H-indole-5-carboxylic acid.
| Compound Name | 3-[(3-carboxyphenyl)diazenyl]-2-hydroxy-1H-indole-5-carboxylic acid |
|---|---|
| PubChem CID | 135924021 |
| Molecular Formula | C16H11N3O5 |
| Molecular Weight | 325.28 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 3-[(3-carboxyphenyl)diazenyl]-2-hydroxy-1H-indole-5-carboxylic acid |
| SMILES | O=C(O)c1cccc(/N=N/c2c(O)[nH]c3ccc(C(=O)O)cc23)c1 |
| InChI | InChI=1S/C16H11N3O5/c20-14-13(11-7-9(16(23)24)4-5-12(11)17-14)19-18-10-3-1-2-8(6-10)15(21)22/h1-7,17,20H,(H,21,22)(H,23,24)/b19-18+ |
| InChIKey | BXUVARZUCDCENH-VHEBQXMUSA-N |
| XLogP | 3.69 |
| TPSA | 135.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.28 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|