C23H23N5O5S — CID 135971714
N-(furan-2-ylmethyl)-3-[[2-hydroxy-5-(propan-2-ylsulfamoyl)-1H-indol-3-yl]diazenyl]benzamide (PubChem CID 135971714) has the molecular formula C23H23N5O5S and a molecular weight of 481.53 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-3-[[2-hydroxy-5-(propan-2-ylsulfamoyl)-1H-indol-3-yl]diazenyl]benzamide.
| Compound Name | N-(furan-2-ylmethyl)-3-[[2-hydroxy-5-(propan-2-ylsulfamoyl)-1H-indol-3-yl]diazenyl]benzamide |
|---|---|
| PubChem CID | 135971714 |
| Molecular Formula | C23H23N5O5S |
| Molecular Weight | 481.53 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | N-(furan-2-ylmethyl)-3-[[2-hydroxy-5-(propan-2-ylsulfamoyl)-1H-indol-3-yl]diazenyl]benzamide |
| SMILES | CC(C)NS(=O)(=O)c1ccc2[nH]c(O)c(/N=N/c3cccc(C(=O)NCc4ccco4)c3)c2c1 |
| InChI | InChI=1S/C23H23N5O5S/c1-14(2)28-34(31,32)18-8-9-20-19(12-18)21(23(30)25-20)27-26-16-6-3-5-15(11-16)22(29)24-13-17-7-4-10-33-17/h3-12,14,25,28,30H,13H2,1-2H3,(H,24,29)/b27-26+ |
| InChIKey | WCCJPCOKZSZRLU-CYYJNZCTSA-N |
| XLogP | 4.50 |
| TPSA | 149.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.53 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|