C20H20N2O4S — CID 109064485
3-[(3,5-dimethylphenyl)sulfamoyl]-N-(furan-2-ylmethyl)benzamide (PubChem CID 109064485) has the molecular formula C20H20N2O4S and a molecular weight of 384.46 g/mol. Its IUPAC name is 3-[(3,5-dimethylphenyl)sulfamoyl]-N-(furan-2-ylmethyl)benzamide.
| Compound Name | 3-[(3,5-dimethylphenyl)sulfamoyl]-N-(furan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 109064485 |
| Molecular Formula | C20H20N2O4S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 3-[(3,5-dimethylphenyl)sulfamoyl]-N-(furan-2-ylmethyl)benzamide |
| SMILES | Cc1cc(C)cc(NS(=O)(=O)c2cccc(C(=O)NCc3ccco3)c2)c1 |
| InChI | InChI=1S/C20H20N2O4S/c1-14-9-15(2)11-17(10-14)22-27(24,25)19-7-3-5-16(12-19)20(23)21-13-18-6-4-8-26-18/h3-12,22H,13H2,1-2H3,(H,21,23) |
| InChIKey | HJXCXIRELCOZQS-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |