C21H22N2O4S2 — CID 27824385
N-[2-(furan-2-ylmethylsulfanyl)ethyl]-3-[(3-methylphenyl)sulfamoyl]benzamide (PubChem CID 27824385) has the molecular formula C21H22N2O4S2 and a molecular weight of 430.55 g/mol. Its IUPAC name is N-[2-(furan-2-ylmethylsulfanyl)ethyl]-3-[(3-methylphenyl)sulfamoyl]benzamide.
| Compound Name | N-[2-(furan-2-ylmethylsulfanyl)ethyl]-3-[(3-methylphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 27824385 |
| Molecular Formula | C21H22N2O4S2 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | N-[2-(furan-2-ylmethylsulfanyl)ethyl]-3-[(3-methylphenyl)sulfamoyl]benzamide |
| SMILES | Cc1cccc(NS(=O)(=O)c2cccc(C(=O)NCCSCc3ccco3)c2)c1 |
| InChI | InChI=1S/C21H22N2O4S2/c1-16-5-2-7-18(13-16)23-29(25,26)20-9-3-6-17(14-20)21(24)22-10-12-28-15-19-8-4-11-27-19/h2-9,11,13-14,23H,10,12,15H2,1H3,(H,22,24) |
| InChIKey | PRECXFBHCCAXNR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|