C18H24N2O4S — CID 26909549
3-(dipropylsulfamoyl)-N-(furan-2-ylmethyl)benzamide (PubChem CID 26909549) has the molecular formula C18H24N2O4S and a molecular weight of 364.47 g/mol. Its IUPAC name is 3-(dipropylsulfamoyl)-N-(furan-2-ylmethyl)benzamide.
| Compound Name | 3-(dipropylsulfamoyl)-N-(furan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 26909549 |
| Molecular Formula | C18H24N2O4S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 3-(dipropylsulfamoyl)-N-(furan-2-ylmethyl)benzamide |
| SMILES | CCCN(CCC)S(=O)(=O)c1cccc(C(=O)NCc2ccco2)c1 |
| InChI | InChI=1S/C18H24N2O4S/c1-3-10-20(11-4-2)25(22,23)17-9-5-7-15(13-17)18(21)19-14-16-8-6-12-24-16/h5-9,12-13H,3-4,10-11,14H2,1-2H3,(H,19,21) |
| InChIKey | ZXMMVKIAPORZKT-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |