C25H21ClN2O4S — CID 2704667
3-[benzyl-(2-chlorophenyl)sulfamoyl]-N-(furan-2-ylmethyl)benzamide (PubChem CID 2704667) has the molecular formula C25H21ClN2O4S and a molecular weight of 480.97 g/mol. Its IUPAC name is 3-[benzyl-(2-chlorophenyl)sulfamoyl]-N-(furan-2-ylmethyl)benzamide.
| Compound Name | 3-[benzyl-(2-chlorophenyl)sulfamoyl]-N-(furan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 2704667 |
| Molecular Formula | C25H21ClN2O4S |
| Molecular Weight | 480.97 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | 3-[benzyl-(2-chlorophenyl)sulfamoyl]-N-(furan-2-ylmethyl)benzamide |
| SMILES | O=C(NCc1ccco1)c1cccc(S(=O)(=O)N(Cc2ccccc2)c2ccccc2Cl)c1 |
| InChI | InChI=1S/C25H21ClN2O4S/c26-23-13-4-5-14-24(23)28(18-19-8-2-1-3-9-19)33(30,31)22-12-6-10-20(16-22)25(29)27-17-21-11-7-15-32-21/h1-16H,17-18H2,(H,27,29) |
| InChIKey | WRWDXXAOZDLAQA-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.97 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |