C26H29ClN2O4S — CID 2469428
2-(diethylamino)ethyl 3-[benzyl-(2-chlorophenyl)sulfamoyl]benzoate (PubChem CID 2469428) has the molecular formula C26H29ClN2O4S and a molecular weight of 501.05 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 3-[benzyl-(2-chlorophenyl)sulfamoyl]benzoate.
| Compound Name | 2-(diethylamino)ethyl 3-[benzyl-(2-chlorophenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 2469428 |
| Molecular Formula | C26H29ClN2O4S |
| Molecular Weight | 501.05 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | 2-(diethylamino)ethyl 3-[benzyl-(2-chlorophenyl)sulfamoyl]benzoate |
| SMILES | CCN(CC)CCOC(=O)c1cccc(S(=O)(=O)N(Cc2ccccc2)c2ccccc2Cl)c1 |
| InChI | InChI=1S/C26H29ClN2O4S/c1-3-28(4-2)17-18-33-26(30)22-13-10-14-23(19-22)34(31,32)29(20-21-11-6-5-7-12-21)25-16-9-8-15-24(25)27/h5-16,19H,3-4,17-18,20H2,1-2H3 |
| InChIKey | HRIXJCRZLCDDNC-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.05 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |