C16H14N6O — CID 135418217
(3,5-diamino-4-phenyldiazenylpyrazol-1-yl)-phenylmethanone (PubChem CID 135418217) has the molecular formula C16H14N6O and a molecular weight of 306.33 g/mol. Its IUPAC name is (3,5-diamino-4-phenyldiazenylpyrazol-1-yl)-phenylmethanone.
| Compound Name | (3,5-diamino-4-phenyldiazenylpyrazol-1-yl)-phenylmethanone |
|---|---|
| PubChem CID | 135418217 |
| Molecular Formula | C16H14N6O |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | (3,5-diamino-4-phenyldiazenylpyrazol-1-yl)-phenylmethanone |
| SMILES | Nc1nn(C(=O)c2ccccc2)c(N)c1/N=N/c1ccccc1 |
| InChI | InChI=1S/C16H14N6O/c17-14-13(20-19-12-9-5-2-6-10-12)15(18)22(21-14)16(23)11-7-3-1-4-8-11/h1-10H,18H2,(H2,17,21)/b20-19+ |
| InChIKey | IFGLKCAHWDTUSU-FMQUCBEESA-N |
| XLogP | 3.15 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|