C21H18N6O3 — CID 136736135
6-acetyl-2-amino-7-(4-methoxyphenyl)-3-phenyldiazenyl-4H-pyrazolo[1,5-a]pyrimidin-5-one (PubChem CID 136736135) has the molecular formula C21H18N6O3 and a molecular weight of 402.41 g/mol. Its IUPAC name is 6-acetyl-2-amino-7-(4-methoxyphenyl)-3-phenyldiazenyl-4H-pyrazolo[1,5-a]pyrimidin-5-one.
| Compound Name | 6-acetyl-2-amino-7-(4-methoxyphenyl)-3-phenyldiazenyl-4H-pyrazolo[1,5-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 136736135 |
| Molecular Formula | C21H18N6O3 |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 6-acetyl-2-amino-7-(4-methoxyphenyl)-3-phenyldiazenyl-4H-pyrazolo[1,5-a]pyrimidin-5-one |
| SMILES | COc1ccc(-c2c(C(C)=O)c(=O)[nH]c3c(/N=N/c4ccccc4)c(N)nn23)cc1 |
| InChI | InChI=1S/C21H18N6O3/c1-12(28)16-18(13-8-10-15(30-2)11-9-13)27-20(23-21(16)29)17(19(22)26-27)25-24-14-6-4-3-5-7-14/h3-11H,1-2H3,(H2,22,26)(H,23,29)/b25-24+ |
| InChIKey | KTHUZFAPKGJEPC-OCOZRVBESA-N |
| XLogP | 3.90 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|