C30H23N7O — CID 136756425
(2,6-diphenyl-3-phenyldiazenyl-1H-imidazo[2,1-e]pyrazol-7-yl)-(4-methoxyphenyl)diazene (PubChem CID 136756425) has the molecular formula C30H23N7O and a molecular weight of 497.56 g/mol. Its IUPAC name is (2,6-diphenyl-3-phenyldiazenyl-1H-imidazo[2,1-e]pyrazol-7-yl)-(4-methoxyphenyl)diazene.
| Compound Name | (2,6-diphenyl-3-phenyldiazenyl-1H-imidazo[2,1-e]pyrazol-7-yl)-(4-methoxyphenyl)diazene |
|---|---|
| PubChem CID | 136756425 |
| Molecular Formula | C30H23N7O |
| Molecular Weight | 497.56 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | (2,6-diphenyl-3-phenyldiazenyl-1H-imidazo[2,1-e]pyrazol-7-yl)-(4-methoxyphenyl)diazene |
| SMILES | COc1ccc(/N=N/c2c(-c3ccccc3)nn3c(/N=N/c4ccccc4)c(-c4ccccc4)[nH]c23)cc1 |
| InChI | InChI=1S/C30H23N7O/c1-38-25-19-17-24(18-20-25)32-34-28-26(21-11-5-2-6-12-21)36-37-29(28)31-27(22-13-7-3-8-14-22)30(37)35-33-23-15-9-4-10-16-23/h2-20,31H,1H3/b34-32+,35-33+ |
| InChIKey | PFPZTAANYNHBJJ-XUXOKTBYSA-N |
| XLogP | 8.84 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.56 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|